![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| _notes/ | 2004-03-17 14:43 | - | |
| Icon | 2004-03-17 14:43 | 0 | |
| acrabat.gif | 2008-09-30 15:38 | 88 | |
| emr_PJB583-6_revised..> | 2008-09-30 15:38 | 1.8K | |
| Silver_staining_of_S..> | 2008-09-30 15:38 | 2.1K | |
| BMMY,_BMGY_recipes.pdf | 2008-09-30 15:38 | 2.4K | |
| acid_elution_tips.pdf | 2008-09-30 15:38 | 2.5K | |
| ELISA_.pdf | 2008-09-30 15:38 | 2.6K | |
| TCA_ppt_protocol.pdf | 2008-09-30 15:38 | 2.7K | |
| protocol_FcRn_sortin..> | 2008-09-30 15:38 | 2.7K | |
| Metabolic_Labeling_o..> | 2008-09-30 15:38 | 2.7K | |
| Anti_FcRn_ELISA.pdf | 2008-09-30 15:38 | 2.9K | |
| Pichia_MeOH_inductio..> | 2008-09-30 15:38 | 3.3K | |
| PCR_g_from_c.pdf | 2008-09-30 15:38 | 3.3K | |
| Martin_purif of His_..> | 2008-09-30 15:38 | 3.3K | |
| Immunopptns_(FcRn)_s..> | 2008-09-30 15:38 | 3.5K | |
| Stable transfection ..> | 2008-09-30 15:38 | 3.8K | |
| T_Cell_Receptor.pdf | 2008-09-30 15:38 | 3.9K | |
| HFE_Purification.pdf | 2008-09-30 15:38 | 4.3K | |
| UL18 isolation from ..> | 2008-09-30 15:38 | 4.4K | |
| PIPLC_purification.pdf | 2008-09-30 15:38 | 4.8K | |
| Anti-FcRn_mAb_purifi..> | 2008-09-30 15:38 | 4.9K | |
| Immunopptns - HFE.pdf | 2008-09-30 15:38 | 4.9K | |
| Antibody_purif _Prot..> | 2008-09-30 15:38 | 4.9K | |
| Protocol for Immunos..> | 2008-09-30 15:38 | 5.2K | |
| B27_Purification.pdf | 2008-09-30 15:38 | 5.2K | |
| Antibodies.pdf | 2008-09-30 15:38 | 5.3K | |
| APHIS_regulations_le..> | 2008-09-30 15:38 | 5.5K | |
| Baculovirus-transfec..> | 2008-09-30 15:38 | 5.7K | |
| cloning protocols by..> | 2008-09-30 15:38 | 5.8K | |
| PJB's_cloning_hints.pdf | 2008-09-30 15:38 | 5.8K | |
| 1G3_Column_FcRn_muta..> | 2008-09-30 15:38 | 5.9K | |
| 1G3_Column-short.pdf | 2008-09-30 15:38 | 5.9K | |
| Lipofection_Procedur..> | 2008-09-30 15:38 | 6.0K | |
| FcRn_purification.pdf | 2008-09-30 15:38 | 6.0K | |
| Kdmb2m.pdf | 2008-09-30 15:38 | 6.4K | |
| Immunoprecipitations..> | 2008-09-30 15:38 | 6.6K | |
| Maintenance_of_HFE_p..> | 2008-09-30 15:38 | 6.6K | |
| Kdcb2m.pdf | 2008-09-30 15:38 | 6.6K | |
| How_to_label_DNA_tub..> | 2008-09-30 15:38 | 6.7K | |
| Ca-P_Transfection_MD..> | 2008-09-30 15:38 | 6.7K | |
| Cov_orien_coup.rtf | 2008-09-30 15:38 | 6.9K | |
| Sf9_Spinner_Media_Re..> | 2008-09-30 15:38 | 6.9K | |
| Prep_of_electocomp_c..> | 2008-09-30 15:38 | 6.9K | |
| Scatachard_Analysis.pdf | 2008-09-30 15:38 | 7.2K | |
| B27_binding_assay.pdf | 2008-09-30 15:38 | 7.9K | |
| Ben_protocols.pdf | 2008-09-30 15:38 | 8.1K | |
| Isolation of protein..> | 2008-09-30 15:38 | 8.7K | |
| Equilibrium_Dialysis..> | 2008-09-30 15:38 | 10K | |
| Martin_subcloning pr..> | 2008-09-30 15:38 | 11K | |
| Western_blot.pdf | 2008-09-30 15:38 | 11K | |
| TFR_(histagged)_puri..> | 2008-09-30 15:38 | 11K | |
| U S _Customs_Prot _I..> | 2008-09-30 15:38 | 12K | |
| Site-directed_mutagn..> | 2008-09-30 15:38 | 13K | |
| HFE_purification .pdf | 2008-09-30 15:38 | 14K | |
| Siliconized coversli..> | 2008-09-30 15:38 | 20K | |
| RechargingNibeads.pdf | 2008-09-30 15:38 | 22K | |
| nickel_vs_cobalt.pdf | 2008-09-30 15:38 | 26K | |
| Banana bread.pdf | 2008-09-30 15:38 | 32K | |
| pubqual.pdf | 2008-09-30 15:38 | 33K | |
| Freez_adh_mam.pdf | 2008-09-30 15:38 | 36K | |
| Split_adh_mam.pdf | 2008-09-30 15:38 | 37K | |
| LaserCalibration.pdf | 2008-11-07 13:13 | 39K | |
| Har_proteins.pdf | 2008-09-30 15:38 | 42K | |
| FcRn_sorting.pdf | 2008-09-30 15:38 | 42K | |
| Cov_orien_coup.pdf | 2008-09-30 15:38 | 43K | |
| Martin_purif of His_..> | 2008-09-30 15:38 | 43K | |
| MariasMaxiprep908.pdf | 2008-09-30 15:42 | 44K | |
| PSMA_purifi.pdf | 2008-09-30 15:38 | 44K | |
| Martin_subcloning procd | 2008-09-30 15:38 | 47K | |
| MHCI-REFOLD_FM.pdf | 2015-05-27 16:30 | 56K | |
| Fcalpha.pdf | 2008-09-30 15:38 | 57K | |
| Pouring LB_Agar_Anti..> | 2016-10-04 16:47 | 68K | |
| Western blot KHT.pdf | 2008-09-30 15:38 | 69K | |
| Concentrator.pdf | 2008-09-30 15:38 | 71K | |
| Zip Tip.pdf | 2008-09-30 15:38 | 81K | |
| hepcidin.jpg | 2008-09-30 15:38 | 83K | |
| QuikChangeSDM.pdf | 2015-09-03 14:52 | 85K | |
| Biacore.pdf | 2008-09-30 15:38 | 86K | |
| Tissue_cul_guide.pdf | 2008-09-30 15:38 | 89K | |
| cover3.gif | 2008-09-30 15:38 | 89K | |
| Fab production.pdf | 2004-03-17 14:43 | 93K | |
| Fab Production.pdf | 2008-09-30 15:38 | 93K | |
| OS for TRX-htt purif..> | 2008-09-30 15:38 | 100K | |
| Molecular movies.pdf | 2008-09-30 15:38 | 108K | |
| aphis_ltr.pdf | 2008-09-30 15:38 | 115K | |
| PSliz,Harvard606_2.pdf | 2008-09-30 15:38 | 120K | |
| PSliz,Harvard606.pdf | 2008-09-30 15:38 | 122K | |
| GibsonCloning.pdf | 2015-09-03 14:50 | 132K | |
| RestrictionCloning.pdf | 2015-09-03 14:52 | 138K | |
| cover1.gif | 2008-09-30 15:38 | 160K | |
| cover2.gif | 2008-09-30 15:38 | 177K | |
| Plots_errorbars.pdf | 2023-03-23 16:18 | 195K | |
| AP205 phage (VLP) ex..> | 2019-05-15 15:53 | 229K | |
| antibds_Inc.pdf | 2008-09-30 15:38 | 238K | |
| christina.pdf | 2008-09-30 15:38 | 489K | |
| SPR techniques.pdf | 2022-09-08 15:05 | 529K | |
| BEEFprot.pdf | 2008-09-30 15:38 | 610K | |
| Paper_guidelines.pdf | 2021-11-29 12:30 | 891K | |
| elife-45734-v1.pdf | 2019-03-14 11:06 | 1.4M | |
| JKlein_SPR.pdf | 2022-09-02 16:57 | 3.9M | |